C24H31N3O5 — CID 41082821
3,4,5-triethoxy-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide (PubChem CID 41082821) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 41082821 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 3,4,5-triethoxy-N-[(Z)-(4-morpholin-4-ylphenyl)methylideneamino]benzamide |
| SMILES | CCOc1cc(C(=O)N/N=C\c2ccc(N3CCOCC3)cc2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H31N3O5/c1-4-30-21-15-19(16-22(31-5-2)23(21)32-6-3)24(28)26-25-17-18-7-9-20(10-8-18)27-11-13-29-14-12-27/h7-10,15-17H,4-6,11-14H2,1-3H3,(H,26,28)/b25-17- |
| InChIKey | JUYMZCMVEGPVGS-UQQQWYQISA-N |
| XLogP | 3.48 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|