C30H26N4O3 — CID 2343026
N-[(4-morpholin-4-ylphenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide (PubChem CID 2343026) has the molecular formula C30H26N4O3 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylphenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide.
| Compound Name | N-[(4-morpholin-4-ylphenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 2343026 |
| Molecular Formula | C30H26N4O3 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | N-[(4-morpholin-4-ylphenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
| SMILES | O=C(NN=Cc1ccc(N2CCOCC2)cc1)c1ccc(CN2C(=O)c3cccc4cccc2c34)cc1 |
| InChI | InChI=1S/C30H26N4O3/c35-29(32-31-19-21-9-13-25(14-10-21)33-15-17-37-18-16-33)24-11-7-22(8-12-24)20-34-27-6-2-4-23-3-1-5-26(28(23)27)30(34)36/h1-14,19H,15-18,20H2,(H,32,35) |
| InChIKey | YAFDFLFYODHTGZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|