C26H17F2N3O2 — CID 6903945
N-[(E)-(2,6-difluorophenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide (PubChem CID 6903945) has the molecular formula C26H17F2N3O2 and a molecular weight of 441.44 g/mol. Its IUPAC name is N-[(E)-(2,6-difluorophenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide.
| Compound Name | N-[(E)-(2,6-difluorophenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 6903945 |
| Molecular Formula | C26H17F2N3O2 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-[(E)-(2,6-difluorophenyl)methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
| SMILES | O=C(N/N=C/c1c(F)cccc1F)c1ccc(CN2C(=O)c3cccc4cccc2c34)cc1 |
| InChI | InChI=1S/C26H17F2N3O2/c27-21-7-3-8-22(28)20(21)14-29-30-25(32)18-12-10-16(11-13-18)15-31-23-9-2-5-17-4-1-6-19(24(17)23)26(31)33/h1-14H,15H2,(H,30,32)/b29-14+ |
| InChIKey | OLAYSPVTEHLMPF-IPPBACCNSA-N |
| XLogP | 5.04 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|