C28H23N3O2 — CID 4021962
N-[1-(4-methylphenyl)ethylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide (PubChem CID 4021962) has the molecular formula C28H23N3O2 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[1-(4-methylphenyl)ethylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide.
| Compound Name | N-[1-(4-methylphenyl)ethylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 4021962 |
| Molecular Formula | C28H23N3O2 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | N-[1-(4-methylphenyl)ethylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
| SMILES | CC(=NNC(=O)c1ccc(CN2C(=O)c3cccc4cccc2c34)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H23N3O2/c1-18-9-13-21(14-10-18)19(2)29-30-27(32)23-15-11-20(12-16-23)17-31-25-8-4-6-22-5-3-7-24(26(22)25)28(31)33/h3-16H,17H2,1-2H3,(H,30,32) |
| InChIKey | QGWGWEJSJAUOFX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|