C33H24N4O2S — CID 6066360
4-[(2-oxobenzo[cd]indol-1-yl)methyl]-N-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]benzamide (PubChem CID 6066360) has the molecular formula C33H24N4O2S and a molecular weight of 540.65 g/mol. Its IUPAC name is 4-[(2-oxobenzo[cd]indol-1-yl)methyl]-N-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]benzamide.
| Compound Name | 4-[(2-oxobenzo[cd]indol-1-yl)methyl]-N-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 6066360 |
| Molecular Formula | C33H24N4O2S |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.16 |
| IUPAC Name | 4-[(2-oxobenzo[cd]indol-1-yl)methyl]-N-[(Z)-1-(10H-phenothiazin-2-yl)ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(CN2C(=O)c3cccc4cccc2c34)cc1)c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C33H24N4O2S/c1-20(24-16-17-30-27(18-24)34-26-9-2-3-11-29(26)40-30)35-36-32(38)23-14-12-21(13-15-23)19-37-28-10-5-7-22-6-4-8-25(31(22)28)33(37)39/h2-18,34H,19H2,1H3,(H,36,38)/b35-20- |
| InChIKey | KAGDJNZFHQJKTN-OJYCWLPVSA-N |
| XLogP | 7.36 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|