C27H19F2N3O3 — CID 6903993
N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide (PubChem CID 6903993) has the molecular formula C27H19F2N3O3 and a molecular weight of 471.46 g/mol. Its IUPAC name is N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide.
| Compound Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 6903993 |
| Molecular Formula | C27H19F2N3O3 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | N-[(E)-[2-(difluoromethoxy)phenyl]methylideneamino]-4-[(2-oxobenzo[cd]indol-1-yl)methyl]benzamide |
| SMILES | O=C(N/N=C/c1ccccc1OC(F)F)c1ccc(CN2C(=O)c3cccc4cccc2c34)cc1 |
| InChI | InChI=1S/C27H19F2N3O3/c28-27(29)35-23-10-2-1-5-20(23)15-30-31-25(33)19-13-11-17(12-14-19)16-32-22-9-4-7-18-6-3-8-21(24(18)22)26(32)34/h1-15,27H,16H2,(H,31,33)/b30-15+ |
| InChIKey | JACWKZXPNMMZEU-FJEPWZHXSA-N |
| XLogP | 5.37 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|