C26H19N3O3 — CID 139951393
N-(2-aminophenyl)-4-[(1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzamide (PubChem CID 139951393) has the molecular formula C26H19N3O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[(1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[(1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 139951393 |
| Molecular Formula | C26H19N3O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | N-(2-aminophenyl)-4-[(1,3-dioxobenzo[de]isoquinolin-2-yl)methyl]benzamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN2C(=O)c3cccc4cccc(c34)C2=O)cc1 |
| InChI | InChI=1S/C26H19N3O3/c27-21-9-1-2-10-22(21)28-24(30)18-13-11-16(12-14-18)15-29-25(31)19-7-3-5-17-6-4-8-20(23(17)19)26(29)32/h1-14H,15,27H2,(H,28,30) |
| InChIKey | MUJCZTLZNMYBGE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|