C24H18N4O2 — CID 139951411
N-(2-aminophenyl)-6-[(2-oxobenzo[cd]indol-1-yl)methyl]pyridine-3-carboxamide (PubChem CID 139951411) has the molecular formula C24H18N4O2 and a molecular weight of 394.43 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[(2-oxobenzo[cd]indol-1-yl)methyl]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[(2-oxobenzo[cd]indol-1-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139951411 |
| Molecular Formula | C24H18N4O2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | N-(2-aminophenyl)-6-[(2-oxobenzo[cd]indol-1-yl)methyl]pyridine-3-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN2C(=O)c3cccc4cccc2c34)nc1 |
| InChI | InChI=1S/C24H18N4O2/c25-19-8-1-2-9-20(19)27-23(29)16-11-12-17(26-13-16)14-28-21-10-4-6-15-5-3-7-18(22(15)21)24(28)30/h1-13H,14,25H2,(H,27,29) |
| InChIKey | PIFVNBXLDJITHO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|