C18H20N4O2 — CID 11723763
N-(2-aminophenyl)-6-[(pent-4-enoylamino)methyl]pyridine-3-carboxamide (PubChem CID 11723763) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[(pent-4-enoylamino)methyl]pyridine-3-carboxamide.
| Compound Name | N-(2-aminophenyl)-6-[(pent-4-enoylamino)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 11723763 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-(2-aminophenyl)-6-[(pent-4-enoylamino)methyl]pyridine-3-carboxamide |
| SMILES | C=CCCC(=O)NCc1ccc(C(=O)Nc2ccccc2N)cn1 |
| InChI | InChI=1S/C18H20N4O2/c1-2-3-8-17(23)21-12-14-10-9-13(11-20-14)18(24)22-16-7-5-4-6-15(16)19/h2,4-7,9-11H,1,3,8,12,19H2,(H,21,23)(H,22,24) |
| InChIKey | CIZQHXDPVPYHMH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|