C16H13F5N4O2 — CID 10430337
2-N-(2-aminophenyl)-5-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2,5-dicarboxamide (PubChem CID 10430337) has the molecular formula C16H13F5N4O2 and a molecular weight of 388.30 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 10430337 |
| Molecular Formula | C16H13F5N4O2 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-(2,2,3,3,3-pentafluoropropyl)pyridine-2,5-dicarboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(=O)NCC(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H13F5N4O2/c17-15(18,16(19,20)21)8-24-13(26)9-5-6-12(23-7-9)14(27)25-11-4-2-1-3-10(11)22/h1-7H,8,22H2,(H,24,26)(H,25,27) |
| InChIKey | YJYMKQWEMLSXGK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|