C20H22F3N5O2 — CID 155469471
2-N-(2-aminophenyl)-5-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]methyl]pyridine-2,5-dicarboxamide (PubChem CID 155469471) has the molecular formula C20H22F3N5O2 and a molecular weight of 421.42 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]methyl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]methyl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 155469471 |
| Molecular Formula | C20H22F3N5O2 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-[[1-(2,2,2-trifluoroethyl)pyrrolidin-2-yl]methyl]pyridine-2,5-dicarboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(=O)NCC2CCCN2CC(F)(F)F)cn1 |
| InChI | InChI=1S/C20H22F3N5O2/c21-20(22,23)12-28-9-3-4-14(28)11-26-18(29)13-7-8-17(25-10-13)19(30)27-16-6-2-1-5-15(16)24/h1-2,5-8,10,14H,3-4,9,11-12,24H2,(H,26,29)(H,27,30) |
| InChIKey | DGOHUOWTFJMXAS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|