C19H21F2N5O2 — CID 155469490
2-N-(2-aminophenyl)-5-N-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]pyridine-2,5-dicarboxamide (PubChem CID 155469490) has the molecular formula C19H21F2N5O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 155469490 |
| Molecular Formula | C19H21F2N5O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-[1-(2,2-difluoroethyl)pyrrolidin-3-yl]pyridine-2,5-dicarboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(=O)NC2CCN(CC(F)F)C2)cn1 |
| InChI | InChI=1S/C19H21F2N5O2/c20-17(21)11-26-8-7-13(10-26)24-18(27)12-5-6-16(23-9-12)19(28)25-15-4-2-1-3-14(15)22/h1-6,9,13,17H,7-8,10-11,22H2,(H,24,27)(H,25,28) |
| InChIKey | BEKYPMPYLGMOEP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|