C15H16N4O3 — CID 10266798
2-N-(2-aminophenyl)-5-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide (PubChem CID 10266798) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-N-(2-aminophenyl)-5-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-aminophenyl)-5-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 10266798 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-N-(2-aminophenyl)-5-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(C(=O)NCCO)cn1 |
| InChI | InChI=1S/C15H16N4O3/c16-11-3-1-2-4-12(11)19-15(22)13-6-5-10(9-18-13)14(21)17-7-8-20/h1-6,9,20H,7-8,16H2,(H,17,21)(H,19,22) |
| InChIKey | TVZBNXVJJGJKHY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 117.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|