C19H17N3O5S — CID 19970593
2-N-(2-hydroxyethyl)-5-N-naphthalen-2-ylsulfonylpyridine-2,5-dicarboxamide (PubChem CID 19970593) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is 2-N-(2-hydroxyethyl)-5-N-naphthalen-2-ylsulfonylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-hydroxyethyl)-5-N-naphthalen-2-ylsulfonylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970593 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-N-(2-hydroxyethyl)-5-N-naphthalen-2-ylsulfonylpyridine-2,5-dicarboxamide |
| SMILES | O=C(NS(=O)(=O)c1ccc2ccccc2c1)c1ccc(C(=O)NCCO)nc1 |
| InChI | InChI=1S/C19H17N3O5S/c23-10-9-20-19(25)17-8-6-15(12-21-17)18(24)22-28(26,27)16-7-5-13-3-1-2-4-14(13)11-16/h1-8,11-12,23H,9-10H2,(H,20,25)(H,22,24) |
| InChIKey | AQUGDEYNBCLUOP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |