C19H16N2O6S — CID 67749124
ethyl [5-(naphthalen-2-ylsulfonylcarbamoyl)-2-pyridinyl] carbonate (PubChem CID 67749124) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is ethyl [5-(naphthalen-2-ylsulfonylcarbamoyl)-2-pyridinyl] carbonate.
| Compound Name | ethyl [5-(naphthalen-2-ylsulfonylcarbamoyl)-2-pyridinyl] carbonate |
|---|---|
| PubChem CID | 67749124 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | ethyl [5-(naphthalen-2-ylsulfonylcarbamoyl)-2-pyridinyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc3ccccc3c2)cn1 |
| InChI | InChI=1S/C19H16N2O6S/c1-2-26-19(23)27-17-10-8-15(12-20-17)18(22)21-28(24,25)16-9-7-13-5-3-4-6-14(13)11-16/h3-12H,2H2,1H3,(H,21,22) |
| InChIKey | QWLHIVCCDCUDHK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |