C23H27N3O7S — CID 67749274
[5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propyl carbonate (PubChem CID 67749274) has the molecular formula C23H27N3O7S and a molecular weight of 489.55 g/mol. Its IUPAC name is [5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propyl carbonate.
| Compound Name | [5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propyl carbonate |
|---|---|
| PubChem CID | 67749274 |
| Molecular Formula | C23H27N3O7S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | [5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propyl carbonate |
| SMILES | CCCOC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2cccc(C(=O)NC3CCCCC3)c2)cn1 |
| InChI | InChI=1S/C23H27N3O7S/c1-2-13-32-23(29)33-20-12-11-17(15-24-20)22(28)26-34(30,31)19-10-6-7-16(14-19)21(27)25-18-8-4-3-5-9-18/h6-7,10-12,14-15,18H,2-5,8-9,13H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | YWKQYBAUGCXTJR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |