C25H25N3O6S — CID 19928441
propyl 5-[[3-(2-phenylethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928441) has the molecular formula C25H25N3O6S and a molecular weight of 495.56 g/mol. Its IUPAC name is propyl 5-[[3-(2-phenylethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | propyl 5-[[3-(2-phenylethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928441 |
| Molecular Formula | C25H25N3O6S |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | propyl 5-[[3-(2-phenylethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCCOC(=O)c1ccc(C(=O)NS(=O)(=O)c2cccc(C(=O)NCCc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C25H25N3O6S/c1-2-15-34-25(31)22-12-11-20(17-27-22)24(30)28-35(32,33)21-10-6-9-19(16-21)23(29)26-14-13-18-7-4-3-5-8-18/h3-12,16-17H,2,13-15H2,1H3,(H,26,29)(H,28,30) |
| InChIKey | WTVRHGXQNMUVFX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |