C19H21N3O6S — CID 19928023
propyl 5-[[3-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928023) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is propyl 5-[[3-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | propyl 5-[[3-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928023 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | propyl 5-[[3-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCCOC(=O)c1ccc(C(=O)NS(=O)(=O)c2cccc(C(=O)NCC)c2)cn1 |
| InChI | InChI=1S/C19H21N3O6S/c1-3-10-28-19(25)16-9-8-14(12-21-16)18(24)22-29(26,27)15-7-5-6-13(11-15)17(23)20-4-2/h5-9,11-12H,3-4,10H2,1-2H3,(H,20,23)(H,22,24) |
| InChIKey | DSYPTUJJDSLWDM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |