C23H29N3O6S — CID 19928501
propyl 5-[[4-(hexylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928501) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is propyl 5-[[4-(hexylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | propyl 5-[[4-(hexylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928501 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | propyl 5-[[4-(hexylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCCCCCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)OCCC)nc2)cc1 |
| InChI | InChI=1S/C23H29N3O6S/c1-3-5-6-7-14-24-21(27)17-8-11-19(12-9-17)33(30,31)26-22(28)18-10-13-20(25-16-18)23(29)32-15-4-2/h8-13,16H,3-7,14-15H2,1-2H3,(H,24,27)(H,26,28) |
| InChIKey | RGWZIXOLHNFRPK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|