C24H29N3O6S — CID 19928175
cyclohexyl 5-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928175) has the molecular formula C24H29N3O6S and a molecular weight of 487.58 g/mol. Its IUPAC name is cyclohexyl 5-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | cyclohexyl 5-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928175 |
| Molecular Formula | C24H29N3O6S |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.18 |
| IUPAC Name | cyclohexyl 5-[[4-(butylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCCCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)OC3CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C24H29N3O6S/c1-2-3-15-25-22(28)17-9-12-20(13-10-17)34(31,32)27-23(29)18-11-14-21(26-16-18)24(30)33-19-7-5-4-6-8-19/h9-14,16,19H,2-8,15H2,1H3,(H,25,28)(H,27,29) |
| InChIKey | IVXYFLSNRBMJDK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|