C30H33N3O6S — CID 19928433
cyclohexyl 5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928433) has the molecular formula C30H33N3O6S and a molecular weight of 563.68 g/mol. Its IUPAC name is cyclohexyl 5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | cyclohexyl 5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928433 |
| Molecular Formula | C30H33N3O6S |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | cyclohexyl 5-[[4-(4-phenylbutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | O=C(NCCCCc1ccccc1)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)OC3CCCCC3)nc2)cc1 |
| InChI | InChI=1S/C30H33N3O6S/c34-28(31-20-8-7-11-22-9-3-1-4-10-22)23-14-17-26(18-15-23)40(37,38)33-29(35)24-16-19-27(32-21-24)30(36)39-25-12-5-2-6-13-25/h1,3-4,9-10,14-19,21,25H,2,5-8,11-13,20H2,(H,31,34)(H,33,35) |
| InChIKey | QGMUGWPPYFJCFJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|