C26H28N4O7S — CID 70214059
[5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate (PubChem CID 70214059) has the molecular formula C26H28N4O7S and a molecular weight of 540.60 g/mol. Its IUPAC name is [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate.
| Compound Name | [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 70214059 |
| Molecular Formula | C26H28N4O7S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCCc3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C26H28N4O7S/c1-36-17-16-28-26(33)37-23-14-11-21(18-29-23)25(32)30-38(34,35)22-12-9-20(10-13-22)24(31)27-15-5-8-19-6-3-2-4-7-19/h2-4,6-7,9-14,18H,5,8,15-17H2,1H3,(H,27,31)(H,28,33)(H,30,32) |
| InChIKey | JQBXJQBIQZWAMX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|