C25H26N4O7S — CID 70210949
[5-[[3-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate (PubChem CID 70210949) has the molecular formula C25H26N4O7S and a molecular weight of 526.57 g/mol. Its IUPAC name is [5-[[3-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate.
| Compound Name | [5-[[3-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 70210949 |
| Molecular Formula | C25H26N4O7S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | [5-[[3-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate |
| SMILES | O=C(NCCO)Oc1ccc(C(=O)NS(=O)(=O)c2cccc(C(=O)NCCCc3ccccc3)c2)cn1 |
| InChI | InChI=1S/C25H26N4O7S/c30-15-14-27-25(33)36-22-12-11-20(17-28-22)24(32)29-37(34,35)21-10-4-9-19(16-21)23(31)26-13-5-8-18-6-2-1-3-7-18/h1-4,6-7,9-12,16-17,30H,5,8,13-15H2,(H,26,31)(H,27,33)(H,29,32) |
| InChIKey | PRCUPRPQBKQXOL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|