C27H30N4O7S — CID 70213122
[5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate (PubChem CID 70213122) has the molecular formula C27H30N4O7S and a molecular weight of 554.63 g/mol. Its IUPAC name is [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate.
| Compound Name | [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate |
|---|---|
| PubChem CID | 70213122 |
| Molecular Formula | C27H30N4O7S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate |
| SMILES | CCOCCNC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCCc3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C27H30N4O7S/c1-2-37-18-17-29-27(34)38-24-15-12-22(19-30-24)26(33)31-39(35,36)23-13-10-21(11-14-23)25(32)28-16-6-9-20-7-4-3-5-8-20/h3-5,7-8,10-15,19H,2,6,9,16-18H2,1H3,(H,28,32)(H,29,34)(H,31,33) |
| InChIKey | SOAAZXIXBCPTDP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|