C27H28N4O8S — CID 19970466
benzyl 2-[[5-[[4-(2-ethoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]acetate (PubChem CID 19970466) has the molecular formula C27H28N4O8S and a molecular weight of 568.61 g/mol. Its IUPAC name is benzyl 2-[[5-[[4-(2-ethoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]acetate.
| Compound Name | benzyl 2-[[5-[[4-(2-ethoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 19970466 |
| Molecular Formula | C27H28N4O8S |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.16 |
| IUPAC Name | benzyl 2-[[5-[[4-(2-ethoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]acetate |
| SMILES | CCOCCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)NCC(=O)OCc3ccccc3)nc2)cc1 |
| InChI | InChI=1S/C27H28N4O8S/c1-2-38-15-14-28-25(33)20-8-11-22(12-9-20)40(36,37)31-26(34)21-10-13-23(29-16-21)27(35)30-17-24(32)39-18-19-6-4-3-5-7-19/h3-13,16H,2,14-15,17-18H2,1H3,(H,28,33)(H,30,35)(H,31,34) |
| InChIKey | NIYAPVGEQWWBFD-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|