C26H26N4O7S — CID 19970564
2-[[5-[[4-(2-benzamidoethyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]ethyl acetate (PubChem CID 19970564) has the molecular formula C26H26N4O7S and a molecular weight of 538.58 g/mol. Its IUPAC name is 2-[[5-[[4-(2-benzamidoethyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]ethyl acetate.
| Compound Name | 2-[[5-[[4-(2-benzamidoethyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]ethyl acetate |
|---|---|
| PubChem CID | 19970564 |
| Molecular Formula | C26H26N4O7S |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 2-[[5-[[4-(2-benzamidoethyl)phenyl]sulfonylcarbamoyl]pyridine-2-carbonyl]amino]ethyl acetate |
| SMILES | CC(=O)OCCNC(=O)c1ccc(C(=O)NS(=O)(=O)c2ccc(CCNC(=O)c3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C26H26N4O7S/c1-18(31)37-16-15-28-26(34)23-12-9-21(17-29-23)25(33)30-38(35,36)22-10-7-19(8-11-22)13-14-27-24(32)20-5-3-2-4-6-20/h2-12,17H,13-16H2,1H3,(H,27,32)(H,28,34)(H,30,33) |
| InChIKey | SDWUVPHTNXSAMU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 160.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|