C23H28N4O8S — CID 70210874
2-[[5-[[4-[2-(butanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl acetate (PubChem CID 70210874) has the molecular formula C23H28N4O8S and a molecular weight of 520.56 g/mol. Its IUPAC name is 2-[[5-[[4-[2-(butanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl acetate.
| Compound Name | 2-[[5-[[4-[2-(butanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl acetate |
|---|---|
| PubChem CID | 70210874 |
| Molecular Formula | C23H28N4O8S |
| Molecular Weight | 520.56 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | 2-[[5-[[4-[2-(butanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl acetate |
| SMILES | CCCC(=O)NCCc1ccc(S(=O)(=O)NC(=O)c2ccc(OC(=O)NCCOC(C)=O)nc2)cc1 |
| InChI | InChI=1S/C23H28N4O8S/c1-3-4-20(29)24-12-11-17-5-8-19(9-6-17)36(32,33)27-22(30)18-7-10-21(26-15-18)35-23(31)25-13-14-34-16(2)28/h5-10,15H,3-4,11-14H2,1-2H3,(H,24,29)(H,25,31)(H,27,30) |
| InChIKey | DXVDWNYZQVPPQW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.56 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|