C34H34N4O8S — CID 70212857
2-[[5-[[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl 2-methylbenzoate (PubChem CID 70212857) has the molecular formula C34H34N4O8S and a molecular weight of 658.73 g/mol. Its IUPAC name is 2-[[5-[[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl 2-methylbenzoate.
| Compound Name | 2-[[5-[[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl 2-methylbenzoate |
|---|---|
| PubChem CID | 70212857 |
| Molecular Formula | C34H34N4O8S |
| Molecular Weight | 658.73 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | 2-[[5-[[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl]oxycarbonylamino]ethyl 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCCNC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(CCNC(=O)CCc3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C34H34N4O8S/c1-24-7-5-6-10-29(24)33(41)45-22-21-36-34(42)46-31-18-14-27(23-37-31)32(40)38-47(43,44)28-15-11-26(12-16-28)19-20-35-30(39)17-13-25-8-3-2-4-9-25/h2-12,14-16,18,23H,13,17,19-22H2,1H3,(H,35,39)(H,36,42)(H,38,40) |
| InChIKey | HZFFCXZKMRZTEH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 169.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.73 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|