C25H33N3O7S — CID 67749377
[5-[[4-[2-(pentanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] pentyl carbonate (PubChem CID 67749377) has the molecular formula C25H33N3O7S and a molecular weight of 519.62 g/mol. Its IUPAC name is [5-[[4-[2-(pentanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] pentyl carbonate.
| Compound Name | [5-[[4-[2-(pentanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] pentyl carbonate |
|---|---|
| PubChem CID | 67749377 |
| Molecular Formula | C25H33N3O7S |
| Molecular Weight | 519.62 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [5-[[4-[2-(pentanoylamino)ethyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] pentyl carbonate |
| SMILES | CCCCCOC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(CCNC(=O)CCCC)cc2)cn1 |
| InChI | InChI=1S/C25H33N3O7S/c1-3-5-7-17-34-25(31)35-23-14-11-20(18-27-23)24(30)28-36(32,33)21-12-9-19(10-13-21)15-16-26-22(29)8-6-4-2/h9-14,18H,3-8,15-17H2,1-2H3,(H,26,29)(H,28,30) |
| InChIKey | YPVSSSAYCFXRTG-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.62 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|