C27H30N4O6S — CID 19970692
2-N-(2-methoxyethyl)-5-N-[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylpyridine-2,5-dicarboxamide (PubChem CID 19970692) has the molecular formula C27H30N4O6S and a molecular weight of 538.63 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-5-N-[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-methoxyethyl)-5-N-[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970692 |
| Molecular Formula | C27H30N4O6S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 2-N-(2-methoxyethyl)-5-N-[4-[2-(3-phenylpropanoylamino)ethyl]phenyl]sulfonylpyridine-2,5-dicarboxamide |
| SMILES | COCCNC(=O)c1ccc(C(=O)NS(=O)(=O)c2ccc(CCNC(=O)CCc3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C27H30N4O6S/c1-37-18-17-29-27(34)24-13-10-22(19-30-24)26(33)31-38(35,36)23-11-7-21(8-12-23)15-16-28-25(32)14-9-20-5-3-2-4-6-20/h2-8,10-13,19H,9,14-18H2,1H3,(H,28,32)(H,29,34)(H,31,33) |
| InChIKey | NAYKFXCOYUKEQN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|