C29H34N4O8S — CID 19970568
5-N-[4-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide (PubChem CID 19970568) has the molecular formula C29H34N4O8S and a molecular weight of 598.68 g/mol. Its IUPAC name is 5-N-[4-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[4-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970568 |
| Molecular Formula | C29H34N4O8S |
| Molecular Weight | 598.68 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | 5-N-[4-[2-[3-(3,4-dimethoxyphenyl)propanoylamino]ethyl]phenyl]sulfonyl-2-N-(2-methoxyethyl)pyridine-2,5-dicarboxamide |
| SMILES | COCCNC(=O)c1ccc(C(=O)NS(=O)(=O)c2ccc(CCNC(=O)CCc3ccc(OC)c(OC)c3)cc2)cn1 |
| InChI | InChI=1S/C29H34N4O8S/c1-39-17-16-31-29(36)24-11-8-22(19-32-24)28(35)33-42(37,38)23-9-4-20(5-10-23)14-15-30-27(34)13-7-21-6-12-25(40-2)26(18-21)41-3/h4-6,8-12,18-19H,7,13-17H2,1-3H3,(H,30,34)(H,31,36)(H,33,35) |
| InChIKey | BOQIBFWZQJDXLH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 162.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.68 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|