C27H30N4O9S — CID 70210901
[5-[[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate (PubChem CID 70210901) has the molecular formula C27H30N4O9S and a molecular weight of 586.62 g/mol. Its IUPAC name is [5-[[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate.
| Compound Name | [5-[[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 70210901 |
| Molecular Formula | C27H30N4O9S |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | [5-[[4-[2-(3,4-dimethoxyphenyl)ethylcarbamoyl]phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCc3ccc(OC)c(OC)c3)cc2)cn1 |
| InChI | InChI=1S/C27H30N4O9S/c1-37-15-14-29-27(34)40-24-11-7-20(17-30-24)26(33)31-41(35,36)21-8-5-19(6-9-21)25(32)28-13-12-18-4-10-22(38-2)23(16-18)39-3/h4-11,16-17H,12-15H2,1-3H3,(H,28,32)(H,29,34)(H,31,33) |
| InChIKey | PNLJHMQFPUDMFC-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 171.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|