C18H20N4O7S — CID 70213172
[5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate (PubChem CID 70213172) has the molecular formula C18H20N4O7S and a molecular weight of 436.45 g/mol. Its IUPAC name is [5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate.
| Compound Name | [5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 70213172 |
| Molecular Formula | C18H20N4O7S |
| Molecular Weight | 436.45 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-hydroxyethyl)carbamate |
| SMILES | CCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(OC(=O)NCCO)nc2)cc1 |
| InChI | InChI=1S/C18H20N4O7S/c1-2-19-16(24)12-3-6-14(7-4-12)30(27,28)22-17(25)13-5-8-15(21-11-13)29-18(26)20-9-10-23/h3-8,11,23H,2,9-10H2,1H3,(H,19,24)(H,20,26)(H,22,25) |
| InChIKey | NJBAYCWDZXKYEO-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.45 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |