C17H17N3O6S — CID 19928397
methyl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928397) has the molecular formula C17H17N3O6S and a molecular weight of 391.41 g/mol. Its IUPAC name is methyl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928397 |
| Molecular Formula | C17H17N3O6S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | methyl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)OC)nc2)cc1 |
| InChI | InChI=1S/C17H17N3O6S/c1-3-18-15(21)11-4-7-13(8-5-11)27(24,25)20-16(22)12-6-9-14(19-10-12)17(23)26-2/h4-10H,3H2,1-2H3,(H,18,21)(H,20,22) |
| InChIKey | XUNQAJXHNJROSV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |