C23H29N3O6S — CID 19928498
methyl 5-[[4-(dibutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 19928498) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is methyl 5-[[4-(dibutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | methyl 5-[[4-(dibutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 19928498 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | methyl 5-[[4-(dibutylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCCCN(CCCC)C(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)OC)nc2)cc1 |
| InChI | InChI=1S/C23H29N3O6S/c1-4-6-14-26(15-7-5-2)22(28)17-8-11-19(12-9-17)33(30,31)25-21(27)18-10-13-20(24-16-18)23(29)32-3/h8-13,16H,4-7,14-15H2,1-3H3,(H,25,27) |
| InChIKey | CCAVEDVPDZDKLF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |