C19H21N3O6S — CID 67782879
propan-2-yl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate (PubChem CID 67782879) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is propan-2-yl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate.
| Compound Name | propan-2-yl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 67782879 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | propan-2-yl 5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]pyridine-2-carboxylate |
| SMILES | CCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)OC(C)C)nc2)cc1 |
| InChI | InChI=1S/C19H21N3O6S/c1-4-20-17(23)13-5-8-15(9-6-13)29(26,27)22-18(24)14-7-10-16(21-11-14)19(25)28-12(2)3/h5-12H,4H2,1-3H3,(H,20,23)(H,22,24) |
| InChIKey | SYAXTCLVWYTMSZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 131.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |