C20H24N4O8S — CID 70212189
[5-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate (PubChem CID 70212189) has the molecular formula C20H24N4O8S and a molecular weight of 480.50 g/mol. Its IUPAC name is [5-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate.
| Compound Name | [5-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 70212189 |
| Molecular Formula | C20H24N4O8S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | [5-[[4-(2-methoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCOC)cc2)cn1 |
| InChI | InChI=1S/C20H24N4O8S/c1-30-11-9-21-18(25)14-3-6-16(7-4-14)33(28,29)24-19(26)15-5-8-17(23-13-15)32-20(27)22-10-12-31-2/h3-8,13H,9-12H2,1-2H3,(H,21,25)(H,22,27)(H,24,26) |
| InChIKey | GXMDJIYHMJTTNP-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 162.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|