C24H24N4O7S — CID 70213168
[5-[[4-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate (PubChem CID 70213168) has the molecular formula C24H24N4O7S and a molecular weight of 512.54 g/mol. Its IUPAC name is [5-[[4-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate.
| Compound Name | [5-[[4-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
|---|---|
| PubChem CID | 70213168 |
| Molecular Formula | C24H24N4O7S |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | [5-[[4-(benzylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-methoxyethyl)carbamate |
| SMILES | COCCNC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCc3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C24H24N4O7S/c1-34-14-13-25-24(31)35-21-12-9-19(16-26-21)23(30)28-36(32,33)20-10-7-18(8-11-20)22(29)27-15-17-5-3-2-4-6-17/h2-12,16H,13-15H2,1H3,(H,25,31)(H,27,29)(H,28,30) |
| InChIKey | CYCPKDORFHFVJG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|