C28H31N3O7S — CID 67749243
pentan-3-yl [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate (PubChem CID 67749243) has the molecular formula C28H31N3O7S and a molecular weight of 553.64 g/mol. Its IUPAC name is pentan-3-yl [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate.
| Compound Name | pentan-3-yl [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate |
|---|---|
| PubChem CID | 67749243 |
| Molecular Formula | C28H31N3O7S |
| Molecular Weight | 553.64 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | pentan-3-yl [5-[[4-(3-phenylpropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate |
| SMILES | CCC(CC)OC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCCc3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C28H31N3O7S/c1-3-23(4-2)37-28(34)38-25-17-14-22(19-30-25)27(33)31-39(35,36)24-15-12-21(13-16-24)26(32)29-18-8-11-20-9-6-5-7-10-20/h5-7,9-10,12-17,19,23H,3-4,8,11,18H2,1-2H3,(H,29,32)(H,31,33) |
| InChIKey | YUMSWVVEBQSDNH-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.64 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|