C29H33N3O8S — CID 67749392
heptan-4-yl [5-[[4-(2-phenoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate (PubChem CID 67749392) has the molecular formula C29H33N3O8S and a molecular weight of 583.66 g/mol. Its IUPAC name is heptan-4-yl [5-[[4-(2-phenoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate.
| Compound Name | heptan-4-yl [5-[[4-(2-phenoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate |
|---|---|
| PubChem CID | 67749392 |
| Molecular Formula | C29H33N3O8S |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | heptan-4-yl [5-[[4-(2-phenoxyethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] carbonate |
| SMILES | CCCC(CCC)OC(=O)Oc1ccc(C(=O)NS(=O)(=O)c2ccc(C(=O)NCCOc3ccccc3)cc2)cn1 |
| InChI | InChI=1S/C29H33N3O8S/c1-3-8-24(9-4-2)39-29(35)40-26-17-14-22(20-31-26)28(34)32-41(36,37)25-15-12-21(13-16-25)27(33)30-18-19-38-23-10-6-5-7-11-23/h5-7,10-17,20,24H,3-4,8-9,18-19H2,1-2H3,(H,30,33)(H,32,34) |
| InChIKey | AWSWIBHNKBVXRA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 149.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|