C20H24N4O7S — CID 70210869
[5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate (PubChem CID 70210869) has the molecular formula C20H24N4O7S and a molecular weight of 464.50 g/mol. Its IUPAC name is [5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate.
| Compound Name | [5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate |
|---|---|
| PubChem CID | 70210869 |
| Molecular Formula | C20H24N4O7S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | [5-[[4-(ethylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-ethoxyethyl)carbamate |
| SMILES | CCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(OC(=O)NCCOCC)nc2)cc1 |
| InChI | InChI=1S/C20H24N4O7S/c1-3-21-18(25)14-5-8-16(9-6-14)32(28,29)24-19(26)15-7-10-17(23-13-15)31-20(27)22-11-12-30-4-2/h5-10,13H,3-4,11-12H2,1-2H3,(H,21,25)(H,22,27)(H,24,26) |
| InChIKey | WQOJTGUXWSLRAT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|