C24H31ClN4O8S — CID 70214053
[5-[[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-propan-2-yloxyethyl)carbamate (PubChem CID 70214053) has the molecular formula C24H31ClN4O8S and a molecular weight of 571.05 g/mol. Its IUPAC name is [5-[[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-propan-2-yloxyethyl)carbamate.
| Compound Name | [5-[[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-propan-2-yloxyethyl)carbamate |
|---|---|
| PubChem CID | 70214053 |
| Molecular Formula | C24H31ClN4O8S |
| Molecular Weight | 571.05 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | [5-[[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] N-(2-propan-2-yloxyethyl)carbamate |
| SMILES | CCOCCCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(OC(=O)NCCOC(C)C)nc2)c(Cl)c1 |
| InChI | InChI=1S/C24H31ClN4O8S/c1-4-35-12-5-10-26-22(30)17-6-8-20(19(25)14-17)38(33,34)29-23(31)18-7-9-21(28-15-18)37-24(32)27-11-13-36-16(2)3/h6-9,14-16H,4-5,10-13H2,1-3H3,(H,26,30)(H,27,32)(H,29,31) |
| InChIKey | DIDVWIVHPJWHOC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 162.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.05 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|