C23H29ClN4O7S — CID 19970338
5-N-[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonyl-2-N-(2-ethoxyethyl)pyridine-2,5-dicarboxamide (PubChem CID 19970338) has the molecular formula C23H29ClN4O7S and a molecular weight of 541.03 g/mol. Its IUPAC name is 5-N-[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonyl-2-N-(2-ethoxyethyl)pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonyl-2-N-(2-ethoxyethyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970338 |
| Molecular Formula | C23H29ClN4O7S |
| Molecular Weight | 541.03 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | 5-N-[2-chloro-4-(3-ethoxypropylcarbamoyl)phenyl]sulfonyl-2-N-(2-ethoxyethyl)pyridine-2,5-dicarboxamide |
| SMILES | CCOCCCNC(=O)c1ccc(S(=O)(=O)NC(=O)c2ccc(C(=O)NCCOCC)nc2)c(Cl)c1 |
| InChI | InChI=1S/C23H29ClN4O7S/c1-3-34-12-5-10-25-21(29)16-7-9-20(18(24)14-16)36(32,33)28-22(30)17-6-8-19(27-15-17)23(31)26-11-13-35-4-2/h6-9,14-15H,3-5,10-13H2,1-2H3,(H,25,29)(H,26,31)(H,28,30) |
| InChIKey | BSLQFVFGDPZDGZ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.03 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|