C22H26ClN3O8S — CID 67749525
[5-[[4-chloro-3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propan-2-yl carbonate (PubChem CID 67749525) has the molecular formula C22H26ClN3O8S and a molecular weight of 527.98 g/mol. Its IUPAC name is [5-[[4-chloro-3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propan-2-yl carbonate.
| Compound Name | [5-[[4-chloro-3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propan-2-yl carbonate |
|---|---|
| PubChem CID | 67749525 |
| Molecular Formula | C22H26ClN3O8S |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | [5-[[4-chloro-3-(3-ethoxypropylcarbamoyl)phenyl]sulfonylcarbamoyl]-2-pyridinyl] propan-2-yl carbonate |
| SMILES | CCOCCCNC(=O)c1cc(S(=O)(=O)NC(=O)c2ccc(OC(=O)OC(C)C)nc2)ccc1Cl |
| InChI | InChI=1S/C22H26ClN3O8S/c1-4-32-11-5-10-24-21(28)17-12-16(7-8-18(17)23)35(30,31)26-20(27)15-6-9-19(25-13-15)34-22(29)33-14(2)3/h6-9,12-14H,4-5,10-11H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | FYHUIYLWZJRQNU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 149.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|