C19H22N4O7S — CID 19970382
2-N-(2-hydroxyethyl)-5-N-[3-(2-methoxyethylcarbamoyl)phenyl]sulfonylpyridine-2,5-dicarboxamide (PubChem CID 19970382) has the molecular formula C19H22N4O7S and a molecular weight of 450.47 g/mol. Its IUPAC name is 2-N-(2-hydroxyethyl)-5-N-[3-(2-methoxyethylcarbamoyl)phenyl]sulfonylpyridine-2,5-dicarboxamide.
| Compound Name | 2-N-(2-hydroxyethyl)-5-N-[3-(2-methoxyethylcarbamoyl)phenyl]sulfonylpyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970382 |
| Molecular Formula | C19H22N4O7S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-N-(2-hydroxyethyl)-5-N-[3-(2-methoxyethylcarbamoyl)phenyl]sulfonylpyridine-2,5-dicarboxamide |
| SMILES | COCCNC(=O)c1cccc(S(=O)(=O)NC(=O)c2ccc(C(=O)NCCO)nc2)c1 |
| InChI | InChI=1S/C19H22N4O7S/c1-30-10-8-21-17(25)13-3-2-4-15(11-13)31(28,29)23-18(26)14-5-6-16(22-12-14)19(27)20-7-9-24/h2-6,11-12,24H,7-10H2,1H3,(H,20,27)(H,21,25)(H,23,26) |
| InChIKey | SEBQQKGXLOXADC-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 163.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|