C22H28N4O6S — CID 19970700
5-N-[3-(hexylcarbamoyl)phenyl]sulfonyl-2-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide (PubChem CID 19970700) has the molecular formula C22H28N4O6S and a molecular weight of 476.56 g/mol. Its IUPAC name is 5-N-[3-(hexylcarbamoyl)phenyl]sulfonyl-2-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide.
| Compound Name | 5-N-[3-(hexylcarbamoyl)phenyl]sulfonyl-2-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 19970700 |
| Molecular Formula | C22H28N4O6S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 5-N-[3-(hexylcarbamoyl)phenyl]sulfonyl-2-N-(2-hydroxyethyl)pyridine-2,5-dicarboxamide |
| SMILES | CCCCCCNC(=O)c1cccc(S(=O)(=O)NC(=O)c2ccc(C(=O)NCCO)nc2)c1 |
| InChI | InChI=1S/C22H28N4O6S/c1-2-3-4-5-11-23-20(28)16-7-6-8-18(14-16)33(31,32)26-21(29)17-9-10-19(25-15-17)22(30)24-12-13-27/h6-10,14-15,27H,2-5,11-13H2,1H3,(H,23,28)(H,24,30)(H,26,29) |
| InChIKey | JCQVWYXTXFNQOT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 154.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|