C20H24ClN3O5S — CID 139634775
N-[3-(6-chlorohexylcarbamoyl)phenyl]sulfonyl-6-(hydroxymethyl)pyridine-3-carboxamide (PubChem CID 139634775) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is N-[3-(6-chlorohexylcarbamoyl)phenyl]sulfonyl-6-(hydroxymethyl)pyridine-3-carboxamide.
| Compound Name | N-[3-(6-chlorohexylcarbamoyl)phenyl]sulfonyl-6-(hydroxymethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139634775 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N-[3-(6-chlorohexylcarbamoyl)phenyl]sulfonyl-6-(hydroxymethyl)pyridine-3-carboxamide |
| SMILES | O=C(NCCCCCCCl)c1cccc(S(=O)(=O)NC(=O)c2ccc(CO)nc2)c1 |
| InChI | InChI=1S/C20H24ClN3O5S/c21-10-3-1-2-4-11-22-19(26)15-6-5-7-18(12-15)30(28,29)24-20(27)16-8-9-17(14-25)23-13-16/h5-9,12-13,25H,1-4,10-11,14H2,(H,22,26)(H,24,27) |
| InChIKey | TUQMDCXZQLJVJG-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|