C16H17N3O5S — CID 67866388
6-(hydroxymethyl)-N-[4-(propanoylamino)phenyl]sulfonylpyridine-3-carboxamide (PubChem CID 67866388) has the molecular formula C16H17N3O5S and a molecular weight of 363.40 g/mol. Its IUPAC name is 6-(hydroxymethyl)-N-[4-(propanoylamino)phenyl]sulfonylpyridine-3-carboxamide.
| Compound Name | 6-(hydroxymethyl)-N-[4-(propanoylamino)phenyl]sulfonylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 67866388 |
| Molecular Formula | C16H17N3O5S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 6-(hydroxymethyl)-N-[4-(propanoylamino)phenyl]sulfonylpyridine-3-carboxamide |
| SMILES | CCC(=O)Nc1ccc(S(=O)(=O)NC(=O)c2ccc(CO)nc2)cc1 |
| InChI | InChI=1S/C16H17N3O5S/c1-2-15(21)18-12-5-7-14(8-6-12)25(23,24)19-16(22)11-3-4-13(10-20)17-9-11/h3-9,20H,2,10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | AKGQVWMMLVWMCF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |