C25H31N3O6S — CID 19928411
5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid (PubChem CID 19928411) has the molecular formula C25H31N3O6S and a molecular weight of 501.61 g/mol. Its IUPAC name is 5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid.
| Compound Name | 5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 19928411 |
| Molecular Formula | C25H31N3O6S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | 5-[[3-(cyclohexylcarbamoyl)phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
| SMILES | CCCCCc1cc(C(=O)NS(=O)(=O)c2cccc(C(=O)NC3CCCCC3)c2)cnc1C(=O)O |
| InChI | InChI=1S/C25H31N3O6S/c1-2-3-5-9-17-14-19(16-26-22(17)25(31)32)24(30)28-35(33,34)21-13-8-10-18(15-21)23(29)27-20-11-6-4-7-12-20/h8,10,13-16,20H,2-7,9,11-12H2,1H3,(H,27,29)(H,28,30)(H,31,32) |
| InChIKey | FREXXONJJIQQCW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|