C28H37N3O6S — CID 19928140
5-[[3-[2-[(2-cyclohexylacetyl)amino]ethyl]phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid (PubChem CID 19928140) has the molecular formula C28H37N3O6S and a molecular weight of 543.69 g/mol. Its IUPAC name is 5-[[3-[2-[(2-cyclohexylacetyl)amino]ethyl]phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid.
| Compound Name | 5-[[3-[2-[(2-cyclohexylacetyl)amino]ethyl]phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 19928140 |
| Molecular Formula | C28H37N3O6S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 5-[[3-[2-[(2-cyclohexylacetyl)amino]ethyl]phenyl]sulfonylcarbamoyl]-3-pentylpyridine-2-carboxylic acid |
| SMILES | CCCCCc1cc(C(=O)NS(=O)(=O)c2cccc(CCNC(=O)CC3CCCCC3)c2)cnc1C(=O)O |
| InChI | InChI=1S/C28H37N3O6S/c1-2-3-5-12-22-18-23(19-30-26(22)28(34)35)27(33)31-38(36,37)24-13-8-11-21(16-24)14-15-29-25(32)17-20-9-6-4-7-10-20/h8,11,13,16,18-20H,2-7,9-10,12,14-15,17H2,1H3,(H,29,32)(H,31,33)(H,34,35) |
| InChIKey | ZRHLCBUWUZJBAW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 142.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|